C20H26N2O4 — CID 169034373
6-(2,6-dioxo-3-phenylpyrimidin-1-yl)hexyl 2-methylpropanoate (PubChem CID 169034373) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 6-(2,6-dioxo-3-phenylpyrimidin-1-yl)hexyl 2-methylpropanoate.
| Compound Name | 6-(2,6-dioxo-3-phenylpyrimidin-1-yl)hexyl 2-methylpropanoate |
|---|---|
| PubChem CID | 169034373 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 6-(2,6-dioxo-3-phenylpyrimidin-1-yl)hexyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCCCn1c(=O)ccn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H26N2O4/c1-16(2)19(24)26-15-9-4-3-8-13-22-18(23)12-14-21(20(22)25)17-10-6-5-7-11-17/h5-7,10-12,14,16H,3-4,8-9,13,15H2,1-2H3 |
| InChIKey | ONDQXPVERCDFHQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|