C18H21F5N2O4S — CID 169034364
4-[2,4-dioxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1H-pyrimidin-6-yl]butyl 2-methylpropanoate (PubChem CID 169034364) has the molecular formula C18H21F5N2O4S and a molecular weight of 456.43 g/mol. Its IUPAC name is 4-[2,4-dioxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1H-pyrimidin-6-yl]butyl 2-methylpropanoate.
| Compound Name | 4-[2,4-dioxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1H-pyrimidin-6-yl]butyl 2-methylpropanoate |
|---|---|
| PubChem CID | 169034364 |
| Molecular Formula | C18H21F5N2O4S |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[2,4-dioxo-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]-1H-pyrimidin-6-yl]butyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCc1cc(=O)n(-c2ccc(S(F)(F)(F)(F)F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H21F5N2O4S/c1-12(2)17(27)29-10-4-3-5-13-11-16(26)25(18(28)24-13)14-6-8-15(9-7-14)30(19,20,21,22)23/h6-9,11-12H,3-5,10H2,1-2H3,(H,24,28) |
| InChIKey | NWKJMKPKQUNXEU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|