C26H31FO4 — CID 130296599
4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]butyl 2-methylpropanoate (PubChem CID 130296599) has the molecular formula C26H31FO4 and a molecular weight of 426.53 g/mol. Its IUPAC name is 4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]butyl 2-methylpropanoate.
| Compound Name | 4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]butyl 2-methylpropanoate |
|---|---|
| PubChem CID | 130296599 |
| Molecular Formula | C26H31FO4 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 4-[4-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]phenyl]butyl 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(-c2ccc(CCCCOC(=O)C(C)C)cc2)cc1F |
| InChI | InChI=1S/C26H31FO4/c1-18(2)25(28)30-15-6-5-7-20-8-10-21(11-9-20)23-13-12-22(24(27)17-23)14-16-31-26(29)19(3)4/h8-13,17-18H,3,5-7,14-16H2,1-2,4H3 |
| InChIKey | FHBSEGLZZRRWQA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|