C21H18F2O4 — CID 122660269
[2-fluoro-4-[3-fluoro-4-(2-prop-2-enoyloxyethyl)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 122660269) has the molecular formula C21H18F2O4 and a molecular weight of 372.37 g/mol. Its IUPAC name is [2-fluoro-4-[3-fluoro-4-(2-prop-2-enoyloxyethyl)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-fluoro-4-[3-fluoro-4-(2-prop-2-enoyloxyethyl)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122660269 |
| Molecular Formula | C21H18F2O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [2-fluoro-4-[3-fluoro-4-(2-prop-2-enoyloxyethyl)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(-c2ccc(OC(=O)C(=C)C)c(F)c2)cc1F |
| InChI | InChI=1S/C21H18F2O4/c1-4-20(24)26-10-9-14-5-6-15(11-17(14)22)16-7-8-19(18(23)12-16)27-21(25)13(2)3/h4-8,11-12H,1-2,9-10H2,3H3 |
| InChIKey | JXVRTBSJCFJPTD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|