C20H17FO4 — CID 122660279
2-[2-fluoro-4-(4-prop-2-enoyloxyphenyl)phenyl]ethyl prop-2-enoate (PubChem CID 122660279) has the molecular formula C20H17FO4 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4-prop-2-enoyloxyphenyl)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[2-fluoro-4-(4-prop-2-enoyloxyphenyl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 122660279 |
| Molecular Formula | C20H17FO4 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[2-fluoro-4-(4-prop-2-enoyloxyphenyl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(-c2ccc(OC(=O)C=C)cc2)cc1F |
| InChI | InChI=1S/C20H17FO4/c1-3-19(22)24-12-11-15-5-6-16(13-18(15)21)14-7-9-17(10-8-14)25-20(23)4-2/h3-10,13H,1-2,11-12H2 |
| InChIKey | NPLPTOYCXLYNFV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|