About [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate
[4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate (PubChem CID 168764522) has the molecular formula C24H28O8
and a molecular weight of 444.48 g/mol. Its IUPAC name is [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate.
Molecular Properties
| Compound Name | [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate |
| PubChem CID | 168764522 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate |
| SMILES | C=CC(=O)OCCOCCOCCOc1ccc(-c2ccc(OC(=O)CCO)cc2)cc1 |
| InChI | InChI=1S/C24H28O8/c1-2-23(26)31-18-16-29-14-13-28-15-17-30-21-7-3-19(4-8-21)20-5-9-22(10-6-20)32-24(27)11-12-25/h2-10,25H,1,11-18H2 |
| InChIKey | XSUGXQHPDREODG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate?
The IUPAC name of [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate (CID 168764522) is [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate.
What is the SMILES notation for [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate?
The canonical SMILES for [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate is C=CC(=O)OCCOCCOCCOc1ccc(-c2ccc(OC(=O)CCO)cc2)cc1.
What is the InChIKey of [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate?
The InChIKey is XSUGXQHPDREODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O8/c1-2-23(26)31-18-16-29-14-13-28-15-17-30-21-7-3-19(4-8-21)20-5-9-22(10-6-20)32-24(27)11-12-25/h2-10,25H,1,11-18H2.
What are the key properties of [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate?
[4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate has a molecular weight of 444.48 g/mol, XLogP of 2.78, 15 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenyl] 3-hydroxypropanoate is sourced from PubChem (CID 168764522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).