C41H39NO12 — CID 163944613
2-(2-prop-2-enoyloxyethylamino)ethyl 4-[4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoyl]oxybenzoyl]oxyphenyl]benzoate (PubChem CID 163944613) has the molecular formula C41H39NO12 and a molecular weight of 737.76 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethylamino)ethyl 4-[4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoyl]oxybenzoyl]oxyphenyl]benzoate.
| Compound Name | 2-(2-prop-2-enoyloxyethylamino)ethyl 4-[4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoyl]oxybenzoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 163944613 |
| Molecular Formula | C41H39NO12 |
| Molecular Weight | 737.76 g/mol |
| Exact Mass | 737.25 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethylamino)ethyl 4-[4-[4-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]benzoyl]oxybenzoyl]oxyphenyl]benzoate |
| SMILES | C=CC(=O)OCCNCCOC(=O)c1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)c4ccc(OCCOCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H39NO12/c1-3-37(43)50-23-21-42-22-24-52-39(45)31-7-5-29(6-8-31)30-9-17-35(18-10-30)53-41(47)33-13-19-36(20-14-33)54-40(46)32-11-15-34(16-12-32)49-27-25-48-26-28-51-38(44)4-2/h3-20,42H,1-2,21-28H2 |
| InChIKey | RTZZWDGQUXFNKM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|