C57H64O12 — CID 20724288
[4-[6-[4-[4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]phenoxy]hexoxycarbonyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)benzoate (PubChem CID 20724288) has the molecular formula C57H64O12 and a molecular weight of 941.13 g/mol. Its IUPAC name is [4-[6-[4-[4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]phenoxy]hexoxycarbonyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)benzoate.
| Compound Name | [4-[6-[4-[4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]phenoxy]hexoxycarbonyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)benzoate |
|---|---|
| PubChem CID | 20724288 |
| Molecular Formula | C57H64O12 |
| Molecular Weight | 941.13 g/mol |
| Exact Mass | 940.44 |
| IUPAC Name | [4-[6-[4-[4-[[4-(6-prop-2-enoyloxyhexoxy)phenoxy]methoxy]phenyl]phenoxy]hexoxycarbonyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OCOc2ccc(-c3ccc(OCCCCCCOC(=O)c4ccc(OC(=O)c5ccc(CCCCCCOC(=O)C=C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H64O12/c1-3-54(58)64-40-14-6-5-11-17-44-18-20-48(21-19-44)57(61)69-53-32-26-47(27-33-53)56(60)66-42-16-10-8-13-38-62-49-28-22-45(23-29-49)46-24-30-51(31-25-46)67-43-68-52-36-34-50(35-37-52)63-39-12-7-9-15-41-65-55(59)4-2/h3-4,18-37H,1-2,5-17,38-43H2 |
| InChIKey | FRPPPLAJIQSNLR-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.13 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|