C21H18F2O3 — CID 139334672
[2-fluoro-4-[3-fluoro-4-(3-methylbuta-1,3-dien-2-yloxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 139334672) has the molecular formula C21H18F2O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is [2-fluoro-4-[3-fluoro-4-(3-methylbuta-1,3-dien-2-yloxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-fluoro-4-[3-fluoro-4-(3-methylbuta-1,3-dien-2-yloxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139334672 |
| Molecular Formula | C21H18F2O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [2-fluoro-4-[3-fluoro-4-(3-methylbuta-1,3-dien-2-yloxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)Oc1ccc(-c2ccc(OC(=O)C(=C)C)c(F)c2)cc1F |
| InChI | InChI=1S/C21H18F2O3/c1-12(2)14(5)25-19-8-6-15(10-17(19)22)16-7-9-20(18(23)11-16)26-21(24)13(3)4/h6-11H,1,3,5H2,2,4H3 |
| InChIKey | ZVTFZUPBETVNLJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|