C21H22O3 — CID 142602377
3-[4-(4-ethenoxyphenyl)phenyl]propyl 2-methylprop-2-enoate (PubChem CID 142602377) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[4-(4-ethenoxyphenyl)phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-(4-ethenoxyphenyl)phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142602377 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3-[4-(4-ethenoxyphenyl)phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=COc1ccc(-c2ccc(CCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C21H22O3/c1-4-23-20-13-11-19(12-14-20)18-9-7-17(8-10-18)6-5-15-24-21(22)16(2)3/h4,7-14H,1-2,5-6,15H2,3H3 |
| InChIKey | YMGWYVISNBVDJY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|