C34H38O13 — CID 170291208
2-O-[2-[(2-methoxy-2-oxoacetyl)oxymethyl]-2-(2-methylprop-2-enoyloxymethyl)-3-[4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenoxy]propyl] 1-O-methyl oxalate (PubChem CID 170291208) has the molecular formula C34H38O13 and a molecular weight of 654.66 g/mol. Its IUPAC name is 2-O-[2-[(2-methoxy-2-oxoacetyl)oxymethyl]-2-(2-methylprop-2-enoyloxymethyl)-3-[4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenoxy]propyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[2-[(2-methoxy-2-oxoacetyl)oxymethyl]-2-(2-methylprop-2-enoyloxymethyl)-3-[4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenoxy]propyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 170291208 |
| Molecular Formula | C34H38O13 |
| Molecular Weight | 654.66 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | 2-O-[2-[(2-methoxy-2-oxoacetyl)oxymethyl]-2-(2-methylprop-2-enoyloxymethyl)-3-[4-[4-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]phenoxy]propyl] 1-O-methyl oxalate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(-c2ccc(OCC(COC(=O)C(=C)C)(COC(=O)C(=O)OC)COC(=O)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C34H38O13/c1-22(2)28(35)43-17-7-8-24-9-11-25(12-10-24)26-13-15-27(16-14-26)44-18-34(19-45-29(36)23(3)4,20-46-32(39)30(37)41-5)21-47-33(40)31(38)42-6/h9-16H,1,3,7-8,17-21H2,2,4-6H3 |
| InChIKey | SVHGBWLKDZUWLW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|