C47H56O12 — CID 155156142
[5-[3-(4-hexylphenoxy)propyl]-2-[4-[2-(2-methylprop-2-enoyloxymethyl)-3-(2-oxopropanoyloxy)-2-(2-oxopropanoyloxymethyl)propoxy]phenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 155156142) has the molecular formula C47H56O12 and a molecular weight of 812.95 g/mol. Its IUPAC name is [5-[3-(4-hexylphenoxy)propyl]-2-[4-[2-(2-methylprop-2-enoyloxymethyl)-3-(2-oxopropanoyloxy)-2-(2-oxopropanoyloxymethyl)propoxy]phenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[3-(4-hexylphenoxy)propyl]-2-[4-[2-(2-methylprop-2-enoyloxymethyl)-3-(2-oxopropanoyloxy)-2-(2-oxopropanoyloxymethyl)propoxy]phenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155156142 |
| Molecular Formula | C47H56O12 |
| Molecular Weight | 812.95 g/mol |
| Exact Mass | 812.38 |
| IUPAC Name | [5-[3-(4-hexylphenoxy)propyl]-2-[4-[2-(2-methylprop-2-enoyloxymethyl)-3-(2-oxopropanoyloxy)-2-(2-oxopropanoyloxymethyl)propoxy]phenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(CCCOc2ccc(CCCCCC)cc2)ccc1-c1ccc(OCC(COC(=O)C(=C)C)(COC(=O)C(C)=O)COC(=O)C(C)=O)cc1 |
| InChI | InChI=1S/C47H56O12/c1-8-9-10-11-13-36-15-20-40(21-16-36)54-25-12-14-37-17-24-42(39(26-37)27-55-43(50)32(2)3)38-18-22-41(23-19-38)56-28-47(29-57-44(51)33(4)5,30-58-45(52)34(6)48)31-59-46(53)35(7)49/h15-24,26H,2,4,8-14,25,27-31H2,1,3,5-7H3 |
| InChIKey | JFACPLNYJRSOTO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.95 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|