C29H29FO5 — CID 155156866
[4-[3-fluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]phenyl]phenyl] 2-methylpropanoate (PubChem CID 155156866) has the molecular formula C29H29FO5 and a molecular weight of 476.54 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]phenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[3-fluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]phenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155156866 |
| Molecular Formula | C29H29FO5 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [4-[3-fluoro-4-[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]phenyl]phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(-c2ccc(-c3ccc(OC(=O)C(C)C)cc3)cc2F)cc1 |
| InChI | InChI=1S/C29H29FO5/c1-19(2)28(31)34-17-5-16-33-24-11-8-22(9-12-24)26-15-10-23(18-27(26)30)21-6-13-25(14-7-21)35-29(32)20(3)4/h6-15,18,20H,1,5,16-17H2,2-4H3 |
| InChIKey | QPPYRXGZHUDATM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|