C29H28FNO3 — CID 123401166
3-[4-[3-fluoro-4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 123401166) has the molecular formula C29H28FNO3 and a molecular weight of 457.55 g/mol. Its IUPAC name is 3-[4-[3-fluoro-4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[3-fluoro-4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123401166 |
| Molecular Formula | C29H28FNO3 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-[4-[3-fluoro-4-[4-(2-methylprop-2-enimidoyloxy)phenyl]phenyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | [H]/N=C(/Oc1ccc(-c2ccc(-c3ccc(CCCOC(=O)C(=C)C)cc3)cc2F)cc1)C(=C)C |
| InChI | InChI=1S/C29H28FNO3/c1-19(2)28(31)34-25-14-11-23(12-15-25)26-16-13-24(18-27(26)30)22-9-7-21(8-10-22)6-5-17-33-29(32)20(3)4/h7-16,18,31H,1,3,5-6,17H2,2,4H3/b31-28+ |
| InChIKey | FNKSZIFCTPCFPD-CCFHIKDMSA-N |
| XLogP | 7.14 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|