C10H13NO4 — CID 176791434
2-(2,5-dioxopyrrol-1-yl)ethyl 2-methylpropanoate (PubChem CID 176791434) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethyl 2-methylpropanoate.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 176791434 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO4/c1-7(2)10(14)15-6-5-11-8(12)3-4-9(11)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | NPTBXZFIOIJNPT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|