C16H25NO4 — CID 175460428
10-(2,5-dioxopyrrol-1-yl)decyl acetate (PubChem CID 175460428) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 10-(2,5-dioxopyrrol-1-yl)decyl acetate.
| Compound Name | 10-(2,5-dioxopyrrol-1-yl)decyl acetate |
|---|---|
| PubChem CID | 175460428 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 10-(2,5-dioxopyrrol-1-yl)decyl acetate |
| SMILES | CC(=O)OCCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H25NO4/c1-14(18)21-13-9-7-5-3-2-4-6-8-12-17-15(19)10-11-16(17)20/h10-11H,2-9,12-13H2,1H3 |
| InChIKey | MDPUQPBWSLHENR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|