About 10-(2,5-dioxopyrrol-1-yl)decyl acetate
10-(2,5-dioxopyrrol-1-yl)decyl acetate (PubChem CID 175460428) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is 10-(2,5-dioxopyrrol-1-yl)decyl acetate.
Molecular Properties
| Compound Name | 10-(2,5-dioxopyrrol-1-yl)decyl acetate |
| PubChem CID | 175460428 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 10-(2,5-dioxopyrrol-1-yl)decyl acetate |
| SMILES | CC(=O)OCCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H25NO4/c1-14(18)21-13-9-7-5-3-2-4-6-8-12-17-15(19)10-11-16(17)20/h10-11H,2-9,12-13H2,1H3 |
| InChIKey | MDPUQPBWSLHENR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 10-(2,5-dioxopyrrol-1-yl)decyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2,5-dioxopyrrol-1-yl)decyl acetate?
The IUPAC name of 10-(2,5-dioxopyrrol-1-yl)decyl acetate (CID 175460428) is 10-(2,5-dioxopyrrol-1-yl)decyl acetate.
What is the SMILES notation for 10-(2,5-dioxopyrrol-1-yl)decyl acetate?
The canonical SMILES for 10-(2,5-dioxopyrrol-1-yl)decyl acetate is CC(=O)OCCCCCCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 10-(2,5-dioxopyrrol-1-yl)decyl acetate?
The InChIKey is MDPUQPBWSLHENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-14(18)21-13-9-7-5-3-2-4-6-8-12-17-15(19)10-11-16(17)20/h10-11H,2-9,12-13H2,1H3.
What are the key properties of 10-(2,5-dioxopyrrol-1-yl)decyl acetate?
10-(2,5-dioxopyrrol-1-yl)decyl acetate has a molecular weight of 295.38 g/mol, XLogP of 2.60, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2,5-dioxopyrrol-1-yl)decyl acetate is sourced from PubChem (CID 175460428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).