C9H16Cl2N2O2 — CID 172909654
1-(5-aminopentyl)pyrrole-2,5-dione;dihydrochloride (PubChem CID 172909654) has the molecular formula C9H16Cl2N2O2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 1-(5-aminopentyl)pyrrole-2,5-dione;dihydrochloride.
| Compound Name | 1-(5-aminopentyl)pyrrole-2,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 172909654 |
| Molecular Formula | C9H16Cl2N2O2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-(5-aminopentyl)pyrrole-2,5-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H14N2O2.2ClH/c10-6-2-1-3-7-11-8(12)4-5-9(11)13;;/h4-5H,1-3,6-7,10H2;2*1H |
| InChIKey | ZSULJGUPNSPFBF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|