C18H31NO2S — CID 173127689
1-(14-sulfanyltetradecyl)pyrrole-2,5-dione (PubChem CID 173127689) has the molecular formula C18H31NO2S and a molecular weight of 325.52 g/mol. Its IUPAC name is 1-(14-sulfanyltetradecyl)pyrrole-2,5-dione.
| Compound Name | 1-(14-sulfanyltetradecyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 173127689 |
| Molecular Formula | C18H31NO2S |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 1-(14-sulfanyltetradecyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCCCCCCCCCCCCS |
| InChI | InChI=1S/C18H31NO2S/c20-17-13-14-18(21)19(17)15-11-9-7-5-3-1-2-4-6-8-10-12-16-22/h13-14,22H,1-12,15-16H2 |
| InChIKey | JKKUYUPZCLMPGJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|