About 1-(6-oxohexyl)pyrrole-2,5-dione;zinc
1-(6-oxohexyl)pyrrole-2,5-dione;zinc (PubChem CID 175747190) has the molecular formula C10H12NO3Zn-
and a molecular weight of 259.60 g/mol. Its IUPAC name is 1-(6-oxohexyl)pyrrole-2,5-dione;zinc.
Molecular Properties
| Compound Name | 1-(6-oxohexyl)pyrrole-2,5-dione;zinc |
| PubChem CID | 175747190 |
| Molecular Formula | C10H12NO3Zn- |
| Molecular Weight | 259.60 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-(6-oxohexyl)pyrrole-2,5-dione;zinc |
| SMILES | O=[C-]CCCCCN1C(=O)C=CC1=O.[Zn] |
| InChI | InChI=1S/C10H12NO3.Zn/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14;/h5-6H,1-4,7H2;/q-1; |
| InChIKey | URLYWHJHVPGEQY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.60 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-oxohexyl)pyrrole-2,5-dione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-oxohexyl)pyrrole-2,5-dione;zinc?
The IUPAC name of 1-(6-oxohexyl)pyrrole-2,5-dione;zinc (CID 175747190) is 1-(6-oxohexyl)pyrrole-2,5-dione;zinc.
What is the SMILES notation for 1-(6-oxohexyl)pyrrole-2,5-dione;zinc?
The canonical SMILES for 1-(6-oxohexyl)pyrrole-2,5-dione;zinc is O=[C-]CCCCCN1C(=O)C=CC1=O.[Zn].
What is the InChIKey of 1-(6-oxohexyl)pyrrole-2,5-dione;zinc?
The InChIKey is URLYWHJHVPGEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO3.Zn/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14;/h5-6H,1-4,7H2;/q-1;.
What are the key properties of 1-(6-oxohexyl)pyrrole-2,5-dione;zinc?
1-(6-oxohexyl)pyrrole-2,5-dione;zinc has a molecular weight of 259.60 g/mol, XLogP of 0.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-oxohexyl)pyrrole-2,5-dione;zinc is sourced from PubChem (CID 175747190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).