C15H23NO2 — CID 86066335
1-undec-10-enylpyrrole-2,5-dione (PubChem CID 86066335) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-undec-10-enylpyrrole-2,5-dione.
| Compound Name | 1-undec-10-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 86066335 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-undec-10-enylpyrrole-2,5-dione |
| SMILES | C=CCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-6-7-8-9-10-13-16-14(17)11-12-15(16)18/h2,11-12H,1,3-10,13H2 |
| InChIKey | PKSNPFQHOHQDCQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|