C24H39N3O3 — CID 153323053
1,3,5-tris(hept-6-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 153323053) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 1,3,5-tris(hept-6-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(hept-6-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153323053 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1,3,5-tris(hept-6-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCCCCCn1c(=O)n(CCCCCC=C)c(=O)n(CCCCCC=C)c1=O |
| InChI | InChI=1S/C24H39N3O3/c1-4-7-10-13-16-19-25-22(28)26(20-17-14-11-8-5-2)24(30)27(23(25)29)21-18-15-12-9-6-3/h4-6H,1-3,7-21H2 |
| InChIKey | VQIGPQCFACMNCG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|