C23H34N2O — CID 155329209
1,3-bis(oct-7-enyl)benzimidazol-2-one (PubChem CID 155329209) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 1,3-bis(oct-7-enyl)benzimidazol-2-one.
| Compound Name | 1,3-bis(oct-7-enyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 155329209 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 1,3-bis(oct-7-enyl)benzimidazol-2-one |
| SMILES | C=CCCCCCCn1c(=O)n(CCCCCCC=C)c2ccccc21 |
| InChI | InChI=1S/C23H34N2O/c1-3-5-7-9-11-15-19-24-21-17-13-14-18-22(21)25(23(24)26)20-16-12-10-8-6-4-2/h3-4,13-14,17-18H,1-2,5-12,15-16,19-20H2 |
| InChIKey | DHKCNGZXSOCITM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|