C12H18N2O2 — CID 169034521
3-oct-7-enyl-1H-pyrimidine-2,4-dione (PubChem CID 169034521) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-oct-7-enyl-1H-pyrimidine-2,4-dione.
| Compound Name | 3-oct-7-enyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169034521 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-oct-7-enyl-1H-pyrimidine-2,4-dione |
| SMILES | C=CCCCCCCn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-5-6-7-10-14-11(15)8-9-13-12(14)16/h2,8-9H,1,3-7,10H2,(H,13,16) |
| InChIKey | NBMPTICSYIEBFW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|