C10H12N4O2 — CID 107104039
3-(3-imidazol-1-ylpropyl)-1H-pyrimidine-2,4-dione (PubChem CID 107104039) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(3-imidazol-1-ylpropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107104039 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-(3-imidazol-1-ylpropyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH]c(=O)n1CCCn1ccnc1 |
| InChI | InChI=1S/C10H12N4O2/c15-9-2-3-12-10(16)14(9)6-1-5-13-7-4-11-8-13/h2-4,7-8H,1,5-6H2,(H,12,16) |
| InChIKey | GBJQSLLFQCALRU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |