C10H12N4O2 — CID 63811711
3-(2-imidazol-1-ylethyl)-1-methylpyrimidine-2,4-dione (PubChem CID 63811711) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-(2-imidazol-1-ylethyl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-(2-imidazol-1-ylethyl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63811711 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-(2-imidazol-1-ylethyl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1ccc(=O)n(CCn2ccnc2)c1=O |
| InChI | InChI=1S/C10H12N4O2/c1-12-4-2-9(15)14(10(12)16)7-6-13-5-3-11-8-13/h2-5,8H,6-7H2,1H3 |
| InChIKey | KRZLLWDMJYHSLM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |