C15H13N3O2 — CID 79241293
1-methyl-3-(quinolin-4-ylmethyl)pyrimidine-2,4-dione (PubChem CID 79241293) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-methyl-3-(quinolin-4-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-(quinolin-4-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79241293 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-methyl-3-(quinolin-4-ylmethyl)pyrimidine-2,4-dione |
| SMILES | Cn1ccc(=O)n(Cc2ccnc3ccccc23)c1=O |
| InChI | InChI=1S/C15H13N3O2/c1-17-9-7-14(19)18(15(17)20)10-11-6-8-16-13-5-3-2-4-12(11)13/h2-9H,10H2,1H3 |
| InChIKey | IERXDYKMRBUWBP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |