C9H14N2O2S — CID 115865604
3-(2-ethylsulfanylethyl)-1-methylpyrimidine-2,4-dione (PubChem CID 115865604) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-(2-ethylsulfanylethyl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115865604 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-1-methylpyrimidine-2,4-dione |
| SMILES | CCSCCn1c(=O)ccn(C)c1=O |
| InChI | InChI=1S/C9H14N2O2S/c1-3-14-7-6-11-8(12)4-5-10(2)9(11)13/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | NFWLFOYKCOVUEN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|