C12H20N2O5 — CID 104567364
3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-methylpyrimidine-2,4-dione (PubChem CID 104567364) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 104567364 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1-methylpyrimidine-2,4-dione |
| SMILES | COCCOCCOCCn1c(=O)ccn(C)c1=O |
| InChI | InChI=1S/C12H20N2O5/c1-13-4-3-11(15)14(12(13)16)5-6-18-9-10-19-8-7-17-2/h3-4H,5-10H2,1-2H3 |
| InChIKey | CETKDRQYYCCBCI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|