C33H57N3O3 — CID 135325486
1,3,5-tris(dec-9-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 135325486) has the molecular formula C33H57N3O3 and a molecular weight of 543.84 g/mol. Its IUPAC name is 1,3,5-tris(dec-9-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(dec-9-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 135325486 |
| Molecular Formula | C33H57N3O3 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.44 |
| IUPAC Name | 1,3,5-tris(dec-9-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCCCCCCCCn1c(=O)n(CCCCCCCCC=C)c(=O)n(CCCCCCCCC=C)c1=O |
| InChI | InChI=1S/C33H57N3O3/c1-4-7-10-13-16-19-22-25-28-34-31(37)35(29-26-23-20-17-14-11-8-5-2)33(39)36(32(34)38)30-27-24-21-18-15-12-9-6-3/h4-6H,1-3,7-30H2 |
| InChIKey | VAXNOJJOBZALPB-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|