C16H27N3O3 — CID 90337163
1-methyl-3-nonyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 90337163) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-methyl-3-nonyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-methyl-3-nonyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90337163 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-methyl-3-nonyl-5-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(C)c(=O)n(CCCCCCCCC)c1=O |
| InChI | InChI=1S/C16H27N3O3/c1-4-6-7-8-9-10-11-13-19-15(21)17(3)14(20)18(12-5-2)16(19)22/h5H,2,4,6-13H2,1,3H3 |
| InChIKey | HQYMOMIQOJTQNB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|