C25H49I2N3O3 — CID 161402210
methane;molecular iodine;1,3,5-triheptyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 161402210) has the molecular formula C25H49I2N3O3 and a molecular weight of 693.49 g/mol. Its IUPAC name is methane;molecular iodine;1,3,5-triheptyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | methane;molecular iodine;1,3,5-triheptyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 161402210 |
| Molecular Formula | C25H49I2N3O3 |
| Molecular Weight | 693.49 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | methane;molecular iodine;1,3,5-triheptyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C.CCCCCCCn1c(=O)n(CCCCCCC)c(=O)n(CCCCCCC)c1=O.II |
| InChI | InChI=1S/C24H45N3O3.CH4.I2/c1-4-7-10-13-16-19-25-22(28)26(20-17-14-11-8-5-2)24(30)27(23(25)29)21-18-15-12-9-6-3;;1-2/h4-21H2,1-3H3;1H4; |
| InChIKey | VUJNUHJFLSZZPY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.49 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|