C22H45N3O9Si2 — CID 157177378
1-pentyl-3,5-bis(4-trimethoxysilylbutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 157177378) has the molecular formula C22H45N3O9Si2 and a molecular weight of 551.79 g/mol. Its IUPAC name is 1-pentyl-3,5-bis(4-trimethoxysilylbutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-pentyl-3,5-bis(4-trimethoxysilylbutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 157177378 |
| Molecular Formula | C22H45N3O9Si2 |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 1-pentyl-3,5-bis(4-trimethoxysilylbutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCn1c(=O)n(CCCC[Si](OC)(OC)OC)c(=O)n(CCCC[Si](OC)(OC)OC)c1=O |
| InChI | InChI=1S/C22H45N3O9Si2/c1-8-9-10-15-23-20(26)24(16-11-13-18-35(29-2,30-3)31-4)22(28)25(21(23)27)17-12-14-19-36(32-5,33-6)34-7/h8-19H2,1-7H3 |
| InChIKey | VVKRNTQVAMDPHU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|