About decyl(trimethoxy)silane;hexyl(trimethoxy)silane
decyl(trimethoxy)silane;hexyl(trimethoxy)silane (PubChem CID 22665206) has the molecular formula C22H52O6Si2
and a molecular weight of 468.82 g/mol. Its IUPAC name is decyl(trimethoxy)silane;hexyl(trimethoxy)silane.
Molecular Properties
| Compound Name | decyl(trimethoxy)silane;hexyl(trimethoxy)silane |
| PubChem CID | 22665206 |
| Molecular Formula | C22H52O6Si2 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | decyl(trimethoxy)silane;hexyl(trimethoxy)silane |
| SMILES | CCCCCCCCCC[Si](OC)(OC)OC.CCCCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H30O3Si.C9H22O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4;1-5-6-7-8-9-13(10-2,11-3)12-4/h5-13H2,1-4H3;5-9H2,1-4H3 |
| InChIKey | SNBNAGXQIAWVAN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decyl(trimethoxy)silane;hexyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(trimethoxy)silane;hexyl(trimethoxy)silane?
The IUPAC name of decyl(trimethoxy)silane;hexyl(trimethoxy)silane (CID 22665206) is decyl(trimethoxy)silane;hexyl(trimethoxy)silane.
What is the SMILES notation for decyl(trimethoxy)silane;hexyl(trimethoxy)silane?
The canonical SMILES for decyl(trimethoxy)silane;hexyl(trimethoxy)silane is CCCCCCCCCC[Si](OC)(OC)OC.CCCCCC[Si](OC)(OC)OC.
What is the InChIKey of decyl(trimethoxy)silane;hexyl(trimethoxy)silane?
The InChIKey is SNBNAGXQIAWVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O3Si.C9H22O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4;1-5-6-7-8-9-13(10-2,11-3)12-4/h5-13H2,1-4H3;5-9H2,1-4H3.
What are the key properties of decyl(trimethoxy)silane;hexyl(trimethoxy)silane?
decyl(trimethoxy)silane;hexyl(trimethoxy)silane has a molecular weight of 468.82 g/mol, XLogP of 6.45, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(trimethoxy)silane;hexyl(trimethoxy)silane is sourced from PubChem (CID 22665206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).