About decyl(trimethoxy)silane;trimethoxysilane
decyl(trimethoxy)silane;trimethoxysilane (PubChem CID 158226172) has the molecular formula C16H40O6Si2
and a molecular weight of 384.66 g/mol. Its IUPAC name is decyl(trimethoxy)silane;trimethoxysilane.
Molecular Properties
| Compound Name | decyl(trimethoxy)silane;trimethoxysilane |
| PubChem CID | 158226172 |
| Molecular Formula | C16H40O6Si2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | decyl(trimethoxy)silane;trimethoxysilane |
| SMILES | CCCCCCCCCC[Si](OC)(OC)OC.CO[SiH](OC)OC |
| InChI | InChI=1S/C13H30O3Si.C3H10O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4;1-4-7(5-2)6-3/h5-13H2,1-4H3;7H,1-3H3 |
| InChIKey | GDVCJRXTOMWMPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decyl(trimethoxy)silane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl(trimethoxy)silane;trimethoxysilane?
The IUPAC name of decyl(trimethoxy)silane;trimethoxysilane (CID 158226172) is decyl(trimethoxy)silane;trimethoxysilane.
What is the SMILES notation for decyl(trimethoxy)silane;trimethoxysilane?
The canonical SMILES for decyl(trimethoxy)silane;trimethoxysilane is CCCCCCCCCC[Si](OC)(OC)OC.CO[SiH](OC)OC.
What is the InChIKey of decyl(trimethoxy)silane;trimethoxysilane?
The InChIKey is GDVCJRXTOMWMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O3Si.C3H10O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4;1-4-7(5-2)6-3/h5-13H2,1-4H3;7H,1-3H3.
What are the key properties of decyl(trimethoxy)silane;trimethoxysilane?
decyl(trimethoxy)silane;trimethoxysilane has a molecular weight of 384.66 g/mol, XLogP of 3.65, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for decyl(trimethoxy)silane;trimethoxysilane is sourced from PubChem (CID 158226172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).