C10H17N3O3 — CID 166726321
1-butyl-3-ethyl-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 166726321) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-butyl-3-ethyl-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-butyl-3-ethyl-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 166726321 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-butyl-3-ethyl-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCn1c(=O)n(C)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C10H17N3O3/c1-4-6-7-13-9(15)11(3)8(14)12(5-2)10(13)16/h4-7H2,1-3H3 |
| InChIKey | JLPHNYAKOQCHSH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |