C13H21N5O2 — CID 82464795
3-butyl-7-ethyl-1-methyl-8-(methylamino)purine-2,6-dione (PubChem CID 82464795) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-butyl-7-ethyl-1-methyl-8-(methylamino)purine-2,6-dione.
| Compound Name | 3-butyl-7-ethyl-1-methyl-8-(methylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 82464795 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-butyl-7-ethyl-1-methyl-8-(methylamino)purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(C)c(=O)c2c1nc(NC)n2CC |
| InChI | InChI=1S/C13H21N5O2/c1-5-7-8-18-10-9(11(19)16(4)13(18)20)17(6-2)12(14-3)15-10/h5-8H2,1-4H3,(H,14,15) |
| InChIKey | JEPCLAWPECTKCW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |