C15H24N4O3 — CID 110882468
3-butyl-1-ethyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione (PubChem CID 110882468) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-butyl-1-ethyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione.
| Compound Name | 3-butyl-1-ethyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 110882468 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-butyl-1-ethyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CC)c(=O)c2c1nc(CO)n2CCC |
| InChI | InChI=1S/C15H24N4O3/c1-4-7-9-19-13-12(14(21)17(6-3)15(19)22)18(8-5-2)11(10-20)16-13/h20H,4-10H2,1-3H3 |
| InChIKey | NFTHYHODJLXKEH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |