C16H24N4O3 — CID 71900474
3-butyl-8-(hydroxymethyl)-1-prop-2-enyl-7-propylpurine-2,6-dione (PubChem CID 71900474) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-butyl-8-(hydroxymethyl)-1-prop-2-enyl-7-propylpurine-2,6-dione.
| Compound Name | 3-butyl-8-(hydroxymethyl)-1-prop-2-enyl-7-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 71900474 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-butyl-8-(hydroxymethyl)-1-prop-2-enyl-7-propylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(nc(CO)n2CCC)n(CCCC)c1=O |
| InChI | InChI=1S/C16H24N4O3/c1-4-7-10-19-14-13(15(22)20(9-6-3)16(19)23)18(8-5-2)12(11-21)17-14/h6,21H,3-5,7-11H2,1-2H3 |
| InChIKey | SBYGPVYQQSTLOU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|