C11H14N4O3 — CID 4125212
8-(hydroxymethyl)-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 4125212) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 8-(hydroxymethyl)-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 8-(hydroxymethyl)-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 4125212 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 8-(hydroxymethyl)-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(CO)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H14N4O3/c1-4-5-15-7(6-16)12-9-8(15)10(17)14(3)11(18)13(9)2/h4,16H,1,5-6H2,2-3H3 |
| InChIKey | KIIPVBOXOCCODW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|