C16H23N5O3S — CID 6458625
N-tert-butyl-2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)sulfanylacetamide (PubChem CID 6458625) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-tert-butyl-2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)sulfanylacetamide.
| Compound Name | N-tert-butyl-2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6458625 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-tert-butyl-2-(1,3-dimethyl-2,6-dioxo-7-prop-2-enylpurin-8-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)NC(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H23N5O3S/c1-7-8-21-11-12(19(5)15(24)20(6)13(11)23)17-14(21)25-9-10(22)18-16(2,3)4/h7H,1,8-9H2,2-6H3,(H,18,22) |
| InChIKey | DJTLHSKNGOSPGN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|