C13H18N6O4S — CID 3178475
N'-acetyl-2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetohydrazide (PubChem CID 3178475) has the molecular formula C13H18N6O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is N'-acetyl-2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 3178475 |
| Molecular Formula | C13H18N6O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N'-acetyl-2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(C)=O)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H18N6O4S/c1-5-19-9-10(17(3)13(23)18(4)11(9)22)14-12(19)24-6-8(21)16-15-7(2)20/h5-6H2,1-4H3,(H,15,20)(H,16,21) |
| InChIKey | OZNDZIUJDOWTAH-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|