C18H20FN7O3S2 — CID 164885621
1-[[2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 164885621) has the molecular formula C18H20FN7O3S2 and a molecular weight of 465.54 g/mol. Its IUPAC name is 1-[[2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 164885621 |
| Molecular Formula | C18H20FN7O3S2 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 1-[[2-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | CCn1c(SCC(=O)NNC(=S)Nc2ccc(F)cc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H20FN7O3S2/c1-4-26-13-14(24(2)18(29)25(3)15(13)28)21-17(26)31-9-12(27)22-23-16(30)20-11-7-5-10(19)6-8-11/h5-8H,4,9H2,1-3H3,(H,22,27)(H2,20,23,30) |
| InChIKey | VDVWWJGLRQHBPW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|