C21H19FN6O5S — CID 3153532
N'-[2-[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 3153532) has the molecular formula C21H19FN6O5S and a molecular weight of 486.49 g/mol. Its IUPAC name is N'-[2-[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 3153532 |
| Molecular Formula | C21H19FN6O5S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N'-[2-[7-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | Cn1c(=O)c2c(nc(SCC(=O)NNC(=O)c3ccco3)n2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H19FN6O5S/c1-26-17-16(19(31)27(2)21(26)32)28(10-12-5-7-13(22)8-6-12)20(23-17)34-11-15(29)24-25-18(30)14-4-3-9-33-14/h3-9H,10-11H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | IQJUGMCVQOGHMI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|