C23H23N5O3S — CID 1173816
N-benzyl-2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide (PubChem CID 1173816) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-benzyl-2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide.
| Compound Name | N-benzyl-2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1173816 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-benzyl-2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
| SMILES | Cn1c(=O)c2c(nc(SCC(=O)NCc3ccccc3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H23N5O3S/c1-26-20-19(21(30)27(2)23(26)31)28(14-17-11-7-4-8-12-17)22(25-20)32-15-18(29)24-13-16-9-5-3-6-10-16/h3-12H,13-15H2,1-2H3,(H,24,29) |
| InChIKey | LKUDKKFMAVESIQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |