C18H22N4O2S — CID 979250
7-benzyl-1,3-dimethyl-8-(2-methylpropylsulfanyl)purine-2,6-dione (PubChem CID 979250) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-(2-methylpropylsulfanyl)purine-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-(2-methylpropylsulfanyl)purine-2,6-dione |
|---|---|
| PubChem CID | 979250 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-(2-methylpropylsulfanyl)purine-2,6-dione |
| SMILES | CC(C)CSc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N4O2S/c1-12(2)11-25-17-19-15-14(16(23)21(4)18(24)20(15)3)22(17)10-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | NLCOIGLJQBEHOK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |