C23H22N4O4S — CID 983101
benzyl 2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate (PubChem CID 983101) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is benzyl 2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate.
| Compound Name | benzyl 2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 983101 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | benzyl 2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
| SMILES | Cn1c(=O)c2c(nc(SCC(=O)OCc3ccccc3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H22N4O4S/c1-25-20-19(21(29)26(2)23(25)30)27(13-16-9-5-3-6-10-16)22(24-20)32-15-18(28)31-14-17-11-7-4-8-12-17/h3-12H,13-15H2,1-2H3 |
| InChIKey | JJLNJFANPYCUQJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |