benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate

C16H15BrN4O4 — CID 979446

IUPACbenzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
SMILESCn1c(=O)c2c(nc(Br)n2CC(=O)OCc2ccccc2)n(C)c1=O
InChIInChI=1S/C16H15BrN4O4/c1-19-13-12(14(23)20(2)16(19)24)21(15(17)18-13)8-11(22)25-9-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3
InChIKeyHXNYAZQFWIXZSX-UHFFFAOYSA-N
MW407.22 g/mol
LogP0.94
Rot. Bonds4

About benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate

benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 979446) has the molecular formula C16H15BrN4O4 and a molecular weight of 407.22 g/mol. Its IUPAC name is benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.

Molecular Properties

Compound Namebenzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
PubChem CID979446
Molecular FormulaC16H15BrN4O4
Molecular Weight407.22 g/mol
Exact Mass406.03
IUPAC Namebenzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
SMILESCn1c(=O)c2c(nc(Br)n2CC(=O)OCc2ccccc2)n(C)c1=O
InChIInChI=1S/C16H15BrN4O4/c1-19-13-12(14(23)20(2)16(19)24)21(15(17)18-13)8-11(22)25-9-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3
InChIKeyHXNYAZQFWIXZSX-UHFFFAOYSA-N
XLogP0.94
TPSA88.12 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500407.22
LogP ≤ 50.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Analyze benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The IUPAC name of benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CID 979446) is benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
What is the SMILES notation for benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The canonical SMILES for benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is Cn1c(=O)c2c(nc(Br)n2CC(=O)OCc2ccccc2)n(C)c1=O.
What is the InChIKey of benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
The InChIKey is HXNYAZQFWIXZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN4O4/c1-19-13-12(14(23)20(2)16(19)24)21(15(17)18-13)8-11(22)25-9-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3.
What are the key properties of benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate?
benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate has a molecular weight of 407.22 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate is sourced from PubChem (CID 979446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).