C16H15BrN4O4 — CID 979446
benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 979446) has the molecular formula C16H15BrN4O4 and a molecular weight of 407.22 g/mol. Its IUPAC name is benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 979446 |
| Molecular Formula | C16H15BrN4O4 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | benzyl 2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | Cn1c(=O)c2c(nc(Br)n2CC(=O)OCc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C16H15BrN4O4/c1-19-13-12(14(23)20(2)16(19)24)21(15(17)18-13)8-11(22)25-9-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | HXNYAZQFWIXZSX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |