C21H25BrN4O4 — CID 22499118
6-(7-benzyl-8-bromo-3-methyl-2,6-dioxopurin-1-yl)hexan-2-yl acetate (PubChem CID 22499118) has the molecular formula C21H25BrN4O4 and a molecular weight of 477.36 g/mol. Its IUPAC name is 6-(7-benzyl-8-bromo-3-methyl-2,6-dioxopurin-1-yl)hexan-2-yl acetate.
| Compound Name | 6-(7-benzyl-8-bromo-3-methyl-2,6-dioxopurin-1-yl)hexan-2-yl acetate |
|---|---|
| PubChem CID | 22499118 |
| Molecular Formula | C21H25BrN4O4 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 6-(7-benzyl-8-bromo-3-methyl-2,6-dioxopurin-1-yl)hexan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCn1c(=O)c2c(nc(Br)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C21H25BrN4O4/c1-14(30-15(2)27)9-7-8-12-25-19(28)17-18(24(3)21(25)29)23-20(22)26(17)13-16-10-5-4-6-11-16/h4-6,10-11,14H,7-9,12-13H2,1-3H3 |
| InChIKey | PIBIHBMJEMRXSK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|