C17H17BrN4O3 — CID 132585713
1-benzyl-8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione (PubChem CID 132585713) has the molecular formula C17H17BrN4O3 and a molecular weight of 405.25 g/mol. Its IUPAC name is 1-benzyl-8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione.
| Compound Name | 1-benzyl-8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 132585713 |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 1-benzyl-8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
| SMILES | CC(=O)C(C)n1c(Br)nc2c1c(=O)n(Cc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C17H17BrN4O3/c1-10(11(2)23)22-13-14(19-16(22)18)20(3)17(25)21(15(13)24)9-12-7-5-4-6-8-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | RWGZUFHEITXTBJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |