C20H17BrN4O3 — CID 2816244
1-benzyl-8-(2-bromophenoxy)-3,7-dimethylpurine-2,6-dione (PubChem CID 2816244) has the molecular formula C20H17BrN4O3 and a molecular weight of 441.29 g/mol. Its IUPAC name is 1-benzyl-8-(2-bromophenoxy)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-benzyl-8-(2-bromophenoxy)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 2816244 |
| Molecular Formula | C20H17BrN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 1-benzyl-8-(2-bromophenoxy)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(Oc2ccccc2Br)nc2c1c(=O)n(Cc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C20H17BrN4O3/c1-23-16-17(22-19(23)28-15-11-7-6-10-14(15)21)24(2)20(27)25(18(16)26)12-13-8-4-3-5-9-13/h3-11H,12H2,1-2H3 |
| InChIKey | HDTVBLGFYPVNPM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |